C20H24ClFN2O4S — CID 132672686
2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[2-(4-methoxyphenyl)ethyl]butanamide (PubChem CID 132672686) has the molecular formula C20H24ClFN2O4S and a molecular weight of 442.94 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[2-(4-methoxyphenyl)ethyl]butanamide.
| Compound Name | 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[2-(4-methoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 132672686 |
| Molecular Formula | C20H24ClFN2O4S |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[2-(4-methoxyphenyl)ethyl]butanamide |
| SMILES | CCC(C(=O)NCCc1ccc(OC)cc1)N(c1ccc(F)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C20H24ClFN2O4S/c1-4-19(20(25)23-12-11-14-5-8-16(28-2)9-6-14)24(29(3,26)27)15-7-10-18(22)17(21)13-15/h5-10,13,19H,4,11-12H2,1-3H3,(H,23,25) |
| InChIKey | LHVYDOAUOXEDQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |