C24H34N2O4S — CID 132673931
N-[1-(2,4-dimethylphenyl)propyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide (PubChem CID 132673931) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)propyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)propyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 132673931 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)propyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide |
| SMILES | CCOc1ccccc1N(CCCC(=O)NC(CC)c1ccc(C)cc1C)S(C)(=O)=O |
| InChI | InChI=1S/C24H34N2O4S/c1-6-21(20-15-14-18(3)17-19(20)4)25-24(27)13-10-16-26(31(5,28)29)22-11-8-9-12-23(22)30-7-2/h8-9,11-12,14-15,17,21H,6-7,10,13,16H2,1-5H3,(H,25,27) |
| InChIKey | LPQFSJAVCQENEB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |