C26H28N2O3S — CID 132674498
4-[benzenesulfonyl(prop-2-enyl)amino]-N-[1-(2,4-dimethylphenyl)ethyl]benzamide (PubChem CID 132674498) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[1-(2,4-dimethylphenyl)ethyl]benzamide.
| Compound Name | 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[1-(2,4-dimethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 132674498 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[1-(2,4-dimethylphenyl)ethyl]benzamide |
| SMILES | C=CCN(c1ccc(C(=O)NC(C)c2ccc(C)cc2C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-5-17-28(32(30,31)24-9-7-6-8-10-24)23-14-12-22(13-15-23)26(29)27-21(4)25-16-11-19(2)18-20(25)3/h5-16,18,21H,1,17H2,2-4H3,(H,27,29) |
| InChIKey | VDEVGWINHZPMFQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|