C15H22BrN7 — CID 13267641
3-[4-[[3-bromo-4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-1H-1,2,4-triazol-5-amine (PubChem CID 13267641) has the molecular formula C15H22BrN7 and a molecular weight of 380.29 g/mol. Its IUPAC name is 3-[4-[[3-bromo-4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[4-[[3-bromo-4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 13267641 |
| Molecular Formula | C15H22BrN7 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-[4-[[3-bromo-4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-1H-1,2,4-triazol-5-amine |
| SMILES | CN(C)c1ccc(CN2CCN(c3n[nH]c(N)n3)CC2)cc1Br |
| InChI | InChI=1S/C15H22BrN7/c1-21(2)13-4-3-11(9-12(13)16)10-22-5-7-23(8-6-22)15-18-14(17)19-20-15/h3-4,9H,5-8,10H2,1-2H3,(H3,17,18,19,20) |
| InChIKey | SENVAEXJOFPRDG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|