C22H28ClN3O4S — CID 132676796
2-[(4-chlorophenyl)methyl-[2-(N-methylsulfonylanilino)acetyl]amino]-N-ethylbutanamide (PubChem CID 132676796) has the molecular formula C22H28ClN3O4S and a molecular weight of 466.00 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(N-methylsulfonylanilino)acetyl]amino]-N-ethylbutanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(N-methylsulfonylanilino)acetyl]amino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 132676796 |
| Molecular Formula | C22H28ClN3O4S |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(N-methylsulfonylanilino)acetyl]amino]-N-ethylbutanamide |
| SMILES | CCNC(=O)C(CC)N(Cc1ccc(Cl)cc1)C(=O)CN(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H28ClN3O4S/c1-4-20(22(28)24-5-2)25(15-17-11-13-18(23)14-12-17)21(27)16-26(31(3,29)30)19-9-7-6-8-10-19/h6-14,20H,4-5,15-16H2,1-3H3,(H,24,28) |
| InChIKey | OVUGIYGGCSLGLZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |