C24H30Cl2N2O2S — CID 132677215
2-[3-benzylsulfanylpropanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-propylbutanamide (PubChem CID 132677215) has the molecular formula C24H30Cl2N2O2S and a molecular weight of 481.49 g/mol. Its IUPAC name is 2-[3-benzylsulfanylpropanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-propylbutanamide.
| Compound Name | 2-[3-benzylsulfanylpropanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132677215 |
| Molecular Formula | C24H30Cl2N2O2S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[3-benzylsulfanylpropanoyl-[(2,4-dichlorophenyl)methyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C24H30Cl2N2O2S/c1-3-13-27-24(30)22(4-2)28(16-19-10-11-20(25)15-21(19)26)23(29)12-14-31-17-18-8-6-5-7-9-18/h5-11,15,22H,3-4,12-14,16-17H2,1-2H3,(H,27,30) |
| InChIKey | OUUSMQUVNLMHPX-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|