C21H26BrN3O4S — CID 132679538
2-[benzyl-[2-(4-bromo-N-methylsulfonylanilino)acetyl]amino]-N-methylbutanamide (PubChem CID 132679538) has the molecular formula C21H26BrN3O4S and a molecular weight of 496.43 g/mol. Its IUPAC name is 2-[benzyl-[2-(4-bromo-N-methylsulfonylanilino)acetyl]amino]-N-methylbutanamide.
| Compound Name | 2-[benzyl-[2-(4-bromo-N-methylsulfonylanilino)acetyl]amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132679538 |
| Molecular Formula | C21H26BrN3O4S |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 2-[benzyl-[2-(4-bromo-N-methylsulfonylanilino)acetyl]amino]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)N(Cc1ccccc1)C(=O)CN(c1ccc(Br)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H26BrN3O4S/c1-4-19(21(27)23-2)24(14-16-8-6-5-7-9-16)20(26)15-25(30(3,28)29)18-12-10-17(22)11-13-18/h5-13,19H,4,14-15H2,1-3H3,(H,23,27) |
| InChIKey | VTUXZFVCKOHFDO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |