About 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide
6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide (PubChem CID 13268091) has the molecular formula C10H9ClN4O2S
and a molecular weight of 284.73 g/mol. Its IUPAC name is 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide |
| PubChem CID | 13268091 |
| Molecular Formula | C10H9ClN4O2S |
| Molecular Weight | 284.73 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)n1c(C#N)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H9ClN4O2S/c1-14(2)18(16,17)15-9-5-7(11)3-4-8(9)13-10(15)6-12/h3-5H,1-2H3 |
| InChIKey | BEZGISVDTFOPKY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.73 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide?
The IUPAC name of 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide (CID 13268091) is 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide.
What is the SMILES notation for 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide?
The canonical SMILES for 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide is CN(C)S(=O)(=O)n1c(C#N)nc2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide?
The InChIKey is BEZGISVDTFOPKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN4O2S/c1-14(2)18(16,17)15-9-5-7(11)3-4-8(9)13-10(15)6-12/h3-5H,1-2H3.
What are the key properties of 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide?
6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide has a molecular weight of 284.73 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-cyano-N,N-dimethylbenzimidazole-1-sulfonamide is sourced from PubChem (CID 13268091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).