C28H33N3O4S — CID 132681026
2-[[2-[N-(benzenesulfonyl)-2-ethylanilino]acetyl]-benzylamino]-N-ethylpropanamide (PubChem CID 132681026) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2-ethylanilino]acetyl]-benzylamino]-N-ethylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2-ethylanilino]acetyl]-benzylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132681026 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2-ethylanilino]acetyl]-benzylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1ccccc1)C(=O)CN(c1ccccc1CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H33N3O4S/c1-4-24-16-12-13-19-26(24)31(36(34,35)25-17-10-7-11-18-25)21-27(32)30(22(3)28(33)29-5-2)20-23-14-8-6-9-15-23/h6-19,22H,4-5,20-21H2,1-3H3,(H,29,33) |
| InChIKey | LAFPGANMSMEXPJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |