C25H34ClN3O4S — CID 132681239
2-[benzyl-[4-(4-chloro-N-methylsulfonylanilino)butanoyl]amino]-N-propylbutanamide (PubChem CID 132681239) has the molecular formula C25H34ClN3O4S and a molecular weight of 508.08 g/mol. Its IUPAC name is 2-[benzyl-[4-(4-chloro-N-methylsulfonylanilino)butanoyl]amino]-N-propylbutanamide.
| Compound Name | 2-[benzyl-[4-(4-chloro-N-methylsulfonylanilino)butanoyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132681239 |
| Molecular Formula | C25H34ClN3O4S |
| Molecular Weight | 508.08 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-[benzyl-[4-(4-chloro-N-methylsulfonylanilino)butanoyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccccc1)C(=O)CCCN(c1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H34ClN3O4S/c1-4-17-27-25(31)23(5-2)28(19-20-10-7-6-8-11-20)24(30)12-9-18-29(34(3,32)33)22-15-13-21(26)14-16-22/h6-8,10-11,13-16,23H,4-5,9,12,17-19H2,1-3H3,(H,27,31) |
| InChIKey | NKQFNWVMQRFKAE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.08 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |