About [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone
[3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone (PubChem CID 13268161) has the molecular formula C22H27NO2
and a molecular weight of 337.46 g/mol. Its IUPAC name is [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone |
| PubChem CID | 13268161 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone |
| SMILES | CC1CN(CC(C)c2cccc(C(=O)c3ccccc3)c2)CC(C)O1 |
| InChI | InChI=1S/C22H27NO2/c1-16(13-23-14-17(2)25-18(3)15-23)20-10-7-11-21(12-20)22(24)19-8-5-4-6-9-19/h4-12,16-18H,13-15H2,1-3H3 |
| InChIKey | YIAPNVVBPJXYHD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone?
The IUPAC name of [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone (CID 13268161) is [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone.
What is the SMILES notation for [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone?
The canonical SMILES for [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone is CC1CN(CC(C)c2cccc(C(=O)c3ccccc3)c2)CC(C)O1.
What is the InChIKey of [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone?
The InChIKey is YIAPNVVBPJXYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO2/c1-16(13-23-14-17(2)25-18(3)15-23)20-10-7-11-21(12-20)22(24)19-8-5-4-6-9-19/h4-12,16-18H,13-15H2,1-3H3.
What are the key properties of [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone?
[3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone has a molecular weight of 337.46 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[1-(2,6-dimethylmorpholin-4-yl)propan-2-yl]phenyl]-phenylmethanone is sourced from PubChem (CID 13268161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).