C28H33N3O5S — CID 132683552
2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]-benzylamino]-N-ethylbutanamide (PubChem CID 132683552) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]-benzylamino]-N-ethylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]-benzylamino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 132683552 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]-benzylamino]-N-ethylbutanamide |
| SMILES | CCNC(=O)C(CC)N(Cc1ccccc1)C(=O)CN(c1cccc(OC)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H33N3O5S/c1-4-26(28(33)29-5-2)30(20-22-13-8-6-9-14-22)27(32)21-31(23-15-12-16-24(19-23)36-3)37(34,35)25-17-10-7-11-18-25/h6-19,26H,4-5,20-21H2,1-3H3,(H,29,33) |
| InChIKey | WFVUVYJQKNTHAM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |