C28H32ClN3O4S — CID 132686473
2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-propylbutanamide (PubChem CID 132686473) has the molecular formula C28H32ClN3O4S and a molecular weight of 542.10 g/mol. Its IUPAC name is 2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-propylbutanamide.
| Compound Name | 2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132686473 |
| Molecular Formula | C28H32ClN3O4S |
| Molecular Weight | 542.10 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccccc1)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H32ClN3O4S/c1-3-19-30-28(34)26(4-2)31(20-22-11-7-5-8-12-22)27(33)21-32(24-13-9-6-10-14-24)37(35,36)25-17-15-23(29)16-18-25/h5-18,26H,3-4,19-21H2,1-2H3,(H,30,34) |
| InChIKey | BTARRGDZFULRSQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.10 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |