C12H20BrNSi2 — CID 13268666
1-(2-bromophenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine (PubChem CID 13268666) has the molecular formula C12H20BrNSi2 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine.
| Compound Name | 1-(2-bromophenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 13268666 |
| Molecular Formula | C12H20BrNSi2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 1-(2-bromophenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1c1ccccc1Br |
| InChI | InChI=1S/C12H20BrNSi2/c1-15(2)9-10-16(3,4)14(15)12-8-6-5-7-11(12)13/h5-8H,9-10H2,1-4H3 |
| InChIKey | QYTVLGYOFANYRB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|