C11H8F5NO — CID 13268818
4,4-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)-5H-1,3-oxazole (PubChem CID 13268818) has the molecular formula C11H8F5NO and a molecular weight of 265.18 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)-5H-1,3-oxazole |
|---|---|
| PubChem CID | 13268818 |
| Molecular Formula | C11H8F5NO |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 4,4-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2c(F)c(F)c(F)c(F)c2F)=N1 |
| InChI | InChI=1S/C11H8F5NO/c1-11(2)3-18-10(17-11)4-5(12)7(14)9(16)8(15)6(4)13/h3H2,1-2H3 |
| InChIKey | OVYZBMJHKGWISL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|