C29H34N4O6S — CID 132690705
2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-propylbutanamide (PubChem CID 132690705) has the molecular formula C29H34N4O6S and a molecular weight of 566.68 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-propylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132690705 |
| Molecular Formula | C29H34N4O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccccc1C)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O6S/c1-4-19-30-29(35)27(5-2)31(20-23-12-10-9-11-22(23)3)28(34)21-32(24-15-17-25(18-16-24)33(36)37)40(38,39)26-13-7-6-8-14-26/h6-18,27H,4-5,19-21H2,1-3H3,(H,30,35) |
| InChIKey | HILLFPNRGFYXMS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|