C22H28IN3O5S — CID 132691929
2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-methylbutanamide (PubChem CID 132691929) has the molecular formula C22H28IN3O5S and a molecular weight of 573.45 g/mol. Its IUPAC name is 2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-methylbutanamide.
| Compound Name | 2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132691929 |
| Molecular Formula | C22H28IN3O5S |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | 2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)N(Cc1ccc(OC)cc1)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H28IN3O5S/c1-5-20(22(28)24-2)25(14-16-6-12-19(31-3)13-7-16)21(27)15-26(32(4,29)30)18-10-8-17(23)9-11-18/h6-13,20H,5,14-15H2,1-4H3,(H,24,28) |
| InChIKey | LZAZGLCOXOKYTE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|