C28H31Cl2N3O4S — CID 132692519
2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]-benzylamino]-N-propylbutanamide (PubChem CID 132692519) has the molecular formula C28H31Cl2N3O4S and a molecular weight of 576.55 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]-benzylamino]-N-propylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]-benzylamino]-N-propylbutanamide |
|---|---|
| PubChem CID | 132692519 |
| Molecular Formula | C28H31Cl2N3O4S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]-benzylamino]-N-propylbutanamide |
| SMILES | CCCNC(=O)C(CC)N(Cc1ccccc1)C(=O)CN(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31Cl2N3O4S/c1-3-17-31-28(35)26(4-2)32(19-21-11-7-5-8-12-21)27(34)20-33(22-15-16-24(29)25(30)18-22)38(36,37)23-13-9-6-10-14-23/h5-16,18,26H,3-4,17,19-20H2,1-2H3,(H,31,35) |
| InChIKey | RFAMECJZLAYYFN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |