About 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole
3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole (PubChem CID 13270207) has the molecular formula C17H17NO4S
and a molecular weight of 331.39 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole |
| PubChem CID | 13270207 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole |
| SMILES | COc1ccc(-c2nsc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C17H17NO4S/c1-19-12-6-5-10(7-13(12)20-2)17-11-8-14(21-3)15(22-4)9-16(11)23-18-17/h5-9H,1-4H3 |
| InChIKey | YPHUSRBXPQRWCG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole (CID 13270207) is 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole is COc1ccc(-c2nsc3cc(OC)c(OC)cc23)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole?
The InChIKey is YPHUSRBXPQRWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4S/c1-19-12-6-5-10(7-13(12)20-2)17-11-8-14(21-3)15(22-4)9-16(11)23-18-17/h5-9H,1-4H3.
What are the key properties of 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole?
3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole has a molecular weight of 331.39 g/mol, XLogP of 4.00, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,2-benzothiazole is sourced from PubChem (CID 13270207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).