C9H11NS — CID 13270248
1,2,3,5-tetrahydro-4,1-benzothiazepine (PubChem CID 13270248) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 1,2,3,5-tetrahydro-4,1-benzothiazepine.
| Compound Name | 1,2,3,5-tetrahydro-4,1-benzothiazepine |
|---|---|
| PubChem CID | 13270248 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 1,2,3,5-tetrahydro-4,1-benzothiazepine |
| SMILES | c1ccc2c(c1)CSCCN2 |
| InChI | InChI=1S/C9H11NS/c1-2-4-9-8(3-1)7-11-6-5-10-9/h1-4,10H,5-7H2 |
| InChIKey | IYXJNKJVUJDDPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |