C24H32N2O3 — CID 132704907
N-tert-butyl-2-[(4-methoxyphenyl)methyl-[2-(2-methylphenyl)acetyl]amino]propanamide (PubChem CID 132704907) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-methoxyphenyl)methyl-[2-(2-methylphenyl)acetyl]amino]propanamide.
| Compound Name | N-tert-butyl-2-[(4-methoxyphenyl)methyl-[2-(2-methylphenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132704907 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-tert-butyl-2-[(4-methoxyphenyl)methyl-[2-(2-methylphenyl)acetyl]amino]propanamide |
| SMILES | COc1ccc(CN(C(=O)Cc2ccccc2C)C(C)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32N2O3/c1-17-9-7-8-10-20(17)15-22(27)26(18(2)23(28)25-24(3,4)5)16-19-11-13-21(29-6)14-12-19/h7-14,18H,15-16H2,1-6H3,(H,25,28) |
| InChIKey | GRQMCHQTYKOXBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |