C23H29ClN2O2 — CID 132705644
2-[(4-chlorophenyl)methyl-[2-(3-methylphenyl)acetyl]amino]-N-(2-methylpropyl)propanamide (PubChem CID 132705644) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(3-methylphenyl)acetyl]amino]-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(3-methylphenyl)acetyl]amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 132705644 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(3-methylphenyl)acetyl]amino]-N-(2-methylpropyl)propanamide |
| SMILES | Cc1cccc(CC(=O)N(Cc2ccc(Cl)cc2)C(C)C(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C23H29ClN2O2/c1-16(2)14-25-23(28)18(4)26(15-19-8-10-21(24)11-9-19)22(27)13-20-7-5-6-17(3)12-20/h5-12,16,18H,13-15H2,1-4H3,(H,25,28) |
| InChIKey | YAWRQQSRHRVLRE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |