C10H14Cl2N2O — CID 13270698
4,5-dichloro-2-hexylpyridazin-3-one (PubChem CID 13270698) has the molecular formula C10H14Cl2N2O and a molecular weight of 249.14 g/mol. Its IUPAC name is 4,5-dichloro-2-hexylpyridazin-3-one.
| Compound Name | 4,5-dichloro-2-hexylpyridazin-3-one |
|---|---|
| PubChem CID | 13270698 |
| Molecular Formula | C10H14Cl2N2O |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 4,5-dichloro-2-hexylpyridazin-3-one |
| SMILES | CCCCCCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H14Cl2N2O/c1-2-3-4-5-6-14-10(15)9(12)8(11)7-13-14/h7H,2-6H2,1H3 |
| InChIKey | BMNZUMKJMOSJJI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|