C24H31ClN2O2 — CID 132708082
N-butan-2-yl-2-[3-(2-chlorophenyl)propanoyl-[(3-methylphenyl)methyl]amino]propanamide (PubChem CID 132708082) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is N-butan-2-yl-2-[3-(2-chlorophenyl)propanoyl-[(3-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-butan-2-yl-2-[3-(2-chlorophenyl)propanoyl-[(3-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132708082 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-butan-2-yl-2-[3-(2-chlorophenyl)propanoyl-[(3-methylphenyl)methyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)C(C)N(Cc1cccc(C)c1)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C24H31ClN2O2/c1-5-18(3)26-24(29)19(4)27(16-20-10-8-9-17(2)15-20)23(28)14-13-21-11-6-7-12-22(21)25/h6-12,15,18-19H,5,13-14,16H2,1-4H3,(H,26,29) |
| InChIKey | NOERQWJLPPHPLJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |