About [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate
[(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate (PubChem CID 13270837) has the molecular formula C16H10F6O6S2
and a molecular weight of 476.37 g/mol. Its IUPAC name is [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate |
| PubChem CID | 13270837 |
| Molecular Formula | C16H10F6O6S2 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O/C(=C(\OS(=O)(=O)C(F)(F)F)c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H10F6O6S2/c17-15(18,19)29(23,24)27-13(11-7-3-1-4-8-11)14(12-9-5-2-6-10-12)28-30(25,26)16(20,21)22/h1-10H/b14-13- |
| InChIKey | DTDHBIKQQKLIPY-YPKPFQOOSA-N |
| XLogP | 4.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate?
The IUPAC name of [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate (CID 13270837) is [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate.
What is the SMILES notation for [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate?
The canonical SMILES for [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate is O=S(=O)(O/C(=C(\OS(=O)(=O)C(F)(F)F)c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate?
The InChIKey is DTDHBIKQQKLIPY-YPKPFQOOSA-N. The full InChI is InChI=1S/C16H10F6O6S2/c17-15(18,19)29(23,24)27-13(11-7-3-1-4-8-11)14(12-9-5-2-6-10-12)28-30(25,26)16(20,21)22/h1-10H/b14-13-.
What are the key properties of [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate?
[(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate has a molecular weight of 476.37 g/mol, XLogP of 4.24, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,2-diphenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate is sourced from PubChem (CID 13270837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).