C25H34N2O4 — CID 132710496
N-tert-butyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(2-methylphenyl)methyl]amino]butanamide (PubChem CID 132710496) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-tert-butyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(2-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-tert-butyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(2-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132710496 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-tert-butyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(2-methylphenyl)methyl]amino]butanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(Cc1ccccc1C)C(=O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H34N2O4/c1-7-22(24(29)26-25(3,4)5)27(16-19-11-9-8-10-18(19)2)23(28)17-31-21-14-12-20(30-6)13-15-21/h8-15,22H,7,16-17H2,1-6H3,(H,26,29) |
| InChIKey | PLBPELWHAMFOHK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |