C25H34N2O2S — CID 132710543
2-[(2-benzylsulfanylacetyl)-[(2-methylphenyl)methyl]amino]-N-(2-methylpropyl)butanamide (PubChem CID 132710543) has the molecular formula C25H34N2O2S and a molecular weight of 426.63 g/mol. Its IUPAC name is 2-[(2-benzylsulfanylacetyl)-[(2-methylphenyl)methyl]amino]-N-(2-methylpropyl)butanamide.
| Compound Name | 2-[(2-benzylsulfanylacetyl)-[(2-methylphenyl)methyl]amino]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 132710543 |
| Molecular Formula | C25H34N2O2S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-[(2-benzylsulfanylacetyl)-[(2-methylphenyl)methyl]amino]-N-(2-methylpropyl)butanamide |
| SMILES | CCC(C(=O)NCC(C)C)N(Cc1ccccc1C)C(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C25H34N2O2S/c1-5-23(25(29)26-15-19(2)3)27(16-22-14-10-9-11-20(22)4)24(28)18-30-17-21-12-7-6-8-13-21/h6-14,19,23H,5,15-18H2,1-4H3,(H,26,29) |
| InChIKey | SZKOKCPVSDFRDU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |