C24H31ClN2O3 — CID 132711719
N-butan-2-yl-2-[(2-chlorophenyl)methyl-[2-(4-ethylphenoxy)acetyl]amino]propanamide (PubChem CID 132711719) has the molecular formula C24H31ClN2O3 and a molecular weight of 430.98 g/mol. Its IUPAC name is N-butan-2-yl-2-[(2-chlorophenyl)methyl-[2-(4-ethylphenoxy)acetyl]amino]propanamide.
| Compound Name | N-butan-2-yl-2-[(2-chlorophenyl)methyl-[2-(4-ethylphenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132711719 |
| Molecular Formula | C24H31ClN2O3 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-butan-2-yl-2-[(2-chlorophenyl)methyl-[2-(4-ethylphenoxy)acetyl]amino]propanamide |
| SMILES | CCc1ccc(OCC(=O)N(Cc2ccccc2Cl)C(C)C(=O)NC(C)CC)cc1 |
| InChI | InChI=1S/C24H31ClN2O3/c1-5-17(3)26-24(29)18(4)27(15-20-9-7-8-10-22(20)25)23(28)16-30-21-13-11-19(6-2)12-14-21/h7-14,17-18H,5-6,15-16H2,1-4H3,(H,26,29) |
| InChIKey | WISNYMDXSBDKQA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |