morpholin-4-ylsulfamic acid

C4H10N2O4S — CID 13271182

IUPACmorpholin-4-ylsulfamic acid
SMILESO=S(=O)(O)NN1CCOCC1
InChIInChI=1S/C4H10N2O4S/c7-11(8,9)5-6-1-3-10-4-2-6/h5H,1-4H2,(H,7,8,9)
InChIKeyQLBMJQIVEOPGHV-UHFFFAOYSA-N
MW182.20 g/mol
LogP-1.37
Rot. Bonds2

About morpholin-4-ylsulfamic acid

morpholin-4-ylsulfamic acid (PubChem CID 13271182) has the molecular formula C4H10N2O4S and a molecular weight of 182.20 g/mol. Its IUPAC name is morpholin-4-ylsulfamic acid.

Molecular Properties

Compound Namemorpholin-4-ylsulfamic acid
PubChem CID13271182
Molecular FormulaC4H10N2O4S
Molecular Weight182.20 g/mol
Exact Mass182.04
IUPAC Namemorpholin-4-ylsulfamic acid
SMILESO=S(=O)(O)NN1CCOCC1
InChIInChI=1S/C4H10N2O4S/c7-11(8,9)5-6-1-3-10-4-2-6/h5H,1-4H2,(H,7,8,9)
InChIKeyQLBMJQIVEOPGHV-UHFFFAOYSA-N
XLogP-1.37
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.20
LogP ≤ 5-1.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze morpholin-4-ylsulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholin-4-ylsulfamic acid?
The IUPAC name of morpholin-4-ylsulfamic acid (CID 13271182) is morpholin-4-ylsulfamic acid.
What is the SMILES notation for morpholin-4-ylsulfamic acid?
The canonical SMILES for morpholin-4-ylsulfamic acid is O=S(=O)(O)NN1CCOCC1.
What is the InChIKey of morpholin-4-ylsulfamic acid?
The InChIKey is QLBMJQIVEOPGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O4S/c7-11(8,9)5-6-1-3-10-4-2-6/h5H,1-4H2,(H,7,8,9).
What are the key properties of morpholin-4-ylsulfamic acid?
morpholin-4-ylsulfamic acid has a molecular weight of 182.20 g/mol, XLogP of -1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-ylsulfamic acid is sourced from PubChem (CID 13271182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).