N-morpholin-4-ylsulfamoyl chloride

C4H9ClN2O3S — CID 13271200

IUPACN-morpholin-4-ylsulfamoyl chloride
SMILESO=S(=O)(Cl)NN1CCOCC1
InChIInChI=1S/C4H9ClN2O3S/c5-11(8,9)6-7-1-3-10-4-2-7/h6H,1-4H2
InChIKeyAXEVAAYUGSXTBP-UHFFFAOYSA-N
MW200.65 g/mol
LogP-0.69
Rot. Bonds2

About N-morpholin-4-ylsulfamoyl chloride

N-morpholin-4-ylsulfamoyl chloride (PubChem CID 13271200) has the molecular formula C4H9ClN2O3S and a molecular weight of 200.65 g/mol. Its IUPAC name is N-morpholin-4-ylsulfamoyl chloride.

Molecular Properties

Compound NameN-morpholin-4-ylsulfamoyl chloride
PubChem CID13271200
Molecular FormulaC4H9ClN2O3S
Molecular Weight200.65 g/mol
Exact Mass200.00
IUPAC NameN-morpholin-4-ylsulfamoyl chloride
SMILESO=S(=O)(Cl)NN1CCOCC1
InChIInChI=1S/C4H9ClN2O3S/c5-11(8,9)6-7-1-3-10-4-2-7/h6H,1-4H2
InChIKeyAXEVAAYUGSXTBP-UHFFFAOYSA-N
XLogP-0.69
TPSA58.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.65
LogP ≤ 5-0.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze N-morpholin-4-ylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-morpholin-4-ylsulfamoyl chloride?
The IUPAC name of N-morpholin-4-ylsulfamoyl chloride (CID 13271200) is N-morpholin-4-ylsulfamoyl chloride.
What is the SMILES notation for N-morpholin-4-ylsulfamoyl chloride?
The canonical SMILES for N-morpholin-4-ylsulfamoyl chloride is O=S(=O)(Cl)NN1CCOCC1.
What is the InChIKey of N-morpholin-4-ylsulfamoyl chloride?
The InChIKey is AXEVAAYUGSXTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9ClN2O3S/c5-11(8,9)6-7-1-3-10-4-2-7/h6H,1-4H2.
What are the key properties of N-morpholin-4-ylsulfamoyl chloride?
N-morpholin-4-ylsulfamoyl chloride has a molecular weight of 200.65 g/mol, XLogP of -0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-morpholin-4-ylsulfamoyl chloride is sourced from PubChem (CID 13271200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).