C23H29ClN2O2S — CID 132712306
N-butan-2-yl-2-[[2-(4-chlorophenyl)sulfanylacetyl]-(2-phenylethyl)amino]propanamide (PubChem CID 132712306) has the molecular formula C23H29ClN2O2S and a molecular weight of 433.02 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-(4-chlorophenyl)sulfanylacetyl]-(2-phenylethyl)amino]propanamide.
| Compound Name | N-butan-2-yl-2-[[2-(4-chlorophenyl)sulfanylacetyl]-(2-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 132712306 |
| Molecular Formula | C23H29ClN2O2S |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-butan-2-yl-2-[[2-(4-chlorophenyl)sulfanylacetyl]-(2-phenylethyl)amino]propanamide |
| SMILES | CCC(C)NC(=O)C(C)N(CCc1ccccc1)C(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN2O2S/c1-4-17(2)25-23(28)18(3)26(15-14-19-8-6-5-7-9-19)22(27)16-29-21-12-10-20(24)11-13-21/h5-13,17-18H,4,14-16H2,1-3H3,(H,25,28) |
| InChIKey | OKKMKLPZIPZFJN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |