About trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane
trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane (PubChem CID 13271347) has the molecular formula C10H18Si
and a molecular weight of 166.34 g/mol. Its IUPAC name is trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane.
Molecular Properties
| Compound Name | trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane |
| PubChem CID | 13271347 |
| Molecular Formula | C10H18Si |
| Molecular Weight | 166.34 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane |
| SMILES | CC1=CC([Si](C)(C)C)=CCC1 |
| InChI | InChI=1S/C10H18Si/c1-9-6-5-7-10(8-9)11(2,3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | XOMJRDPXMOFUNY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane?
The IUPAC name of trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane (CID 13271347) is trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane.
What is the SMILES notation for trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane?
The canonical SMILES for trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane is CC1=CC([Si](C)(C)C)=CCC1.
What is the InChIKey of trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane?
The InChIKey is XOMJRDPXMOFUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Si/c1-9-6-5-7-10(8-9)11(2,3)4/h7-8H,5-6H2,1-4H3.
What are the key properties of trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane?
trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane has a molecular weight of 166.34 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(5-methylcyclohexa-1,5-dien-1-yl)silane is sourced from PubChem (CID 13271347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).