C13H22Si — CID 13271349
4,4a,5,6,7,8-hexahydronaphthalen-2-yl(trimethyl)silane (PubChem CID 13271349) has the molecular formula C13H22Si and a molecular weight of 206.41 g/mol. Its IUPAC name is 4,4a,5,6,7,8-hexahydronaphthalen-2-yl(trimethyl)silane.
| Compound Name | 4,4a,5,6,7,8-hexahydronaphthalen-2-yl(trimethyl)silane |
|---|---|
| PubChem CID | 13271349 |
| Molecular Formula | C13H22Si |
| Molecular Weight | 206.41 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 4,4a,5,6,7,8-hexahydronaphthalen-2-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)C1=CCC2CCCCC2=C1 |
| InChI | InChI=1S/C13H22Si/c1-14(2,3)13-9-8-11-6-4-5-7-12(11)10-13/h9-11H,4-8H2,1-3H3 |
| InChIKey | WYYCUQQWWDYVNA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|