C27H38N2O3 — CID 132713727
N-tert-butyl-2-[4-(4-methylphenoxy)butanoyl-[(3-methylphenyl)methyl]amino]butanamide (PubChem CID 132713727) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(4-methylphenoxy)butanoyl-[(3-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-tert-butyl-2-[4-(4-methylphenoxy)butanoyl-[(3-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132713727 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | N-tert-butyl-2-[4-(4-methylphenoxy)butanoyl-[(3-methylphenyl)methyl]amino]butanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(Cc1cccc(C)c1)C(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C27H38N2O3/c1-7-24(26(31)28-27(4,5)6)29(19-22-11-8-10-21(3)18-22)25(30)12-9-17-32-23-15-13-20(2)14-16-23/h8,10-11,13-16,18,24H,7,9,12,17,19H2,1-6H3,(H,28,31) |
| InChIKey | VDJSQHJUGXXFGM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|