C10H14N2OSi — CID 13271407
2,2,5-trimethyl-3-phenyl-1,3,4,2-oxadiazasilole (PubChem CID 13271407) has the molecular formula C10H14N2OSi and a molecular weight of 206.32 g/mol. Its IUPAC name is 2,2,5-trimethyl-3-phenyl-1,3,4,2-oxadiazasilole.
| Compound Name | 2,2,5-trimethyl-3-phenyl-1,3,4,2-oxadiazasilole |
|---|---|
| PubChem CID | 13271407 |
| Molecular Formula | C10H14N2OSi |
| Molecular Weight | 206.32 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2,2,5-trimethyl-3-phenyl-1,3,4,2-oxadiazasilole |
| SMILES | CC1=NN(c2ccccc2)[Si](C)(C)O1 |
| InChI | InChI=1S/C10H14N2OSi/c1-9-11-12(14(2,3)13-9)10-7-5-4-6-8-10/h4-8H,1-3H3 |
| InChIKey | SGLKFHDZGOXSIX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|