C26H36N2O2S — CID 132714304
N-butyl-2-[[2-[(3-methylphenyl)methylsulfanyl]acetyl]-(2-phenylethyl)amino]butanamide (PubChem CID 132714304) has the molecular formula C26H36N2O2S and a molecular weight of 440.65 g/mol. Its IUPAC name is N-butyl-2-[[2-[(3-methylphenyl)methylsulfanyl]acetyl]-(2-phenylethyl)amino]butanamide.
| Compound Name | N-butyl-2-[[2-[(3-methylphenyl)methylsulfanyl]acetyl]-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132714304 |
| Molecular Formula | C26H36N2O2S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N-butyl-2-[[2-[(3-methylphenyl)methylsulfanyl]acetyl]-(2-phenylethyl)amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(CCc1ccccc1)C(=O)CSCc1cccc(C)c1 |
| InChI | InChI=1S/C26H36N2O2S/c1-4-6-16-27-26(30)24(5-2)28(17-15-22-12-8-7-9-13-22)25(29)20-31-19-23-14-10-11-21(3)18-23/h7-14,18,24H,4-6,15-17,19-20H2,1-3H3,(H,27,30) |
| InChIKey | WGGCJUSQHFDJIH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|