C26H35ClN2O2 — CID 132714894
N-tert-butyl-2-[(2-chlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]butanamide (PubChem CID 132714894) has the molecular formula C26H35ClN2O2 and a molecular weight of 443.03 g/mol. Its IUPAC name is N-tert-butyl-2-[(2-chlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]butanamide.
| Compound Name | N-tert-butyl-2-[(2-chlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]butanamide |
|---|---|
| PubChem CID | 132714894 |
| Molecular Formula | C26H35ClN2O2 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-tert-butyl-2-[(2-chlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]butanamide |
| SMILES | CCc1ccc(CCC(=O)N(Cc2ccccc2Cl)C(CC)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H35ClN2O2/c1-6-19-12-14-20(15-13-19)16-17-24(30)29(18-21-10-8-9-11-22(21)27)23(7-2)25(31)28-26(3,4)5/h8-15,23H,6-7,16-18H2,1-5H3,(H,28,31) |
| InChIKey | MLJWDYNBYWZDFV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |