C7H8F6O2 — CID 13271507
2-(1,1,2,3,3,3-hexafluoropropyl)-1,4-dioxane (PubChem CID 13271507) has the molecular formula C7H8F6O2 and a molecular weight of 238.13 g/mol. Its IUPAC name is 2-(1,1,2,3,3,3-hexafluoropropyl)-1,4-dioxane.
| Compound Name | 2-(1,1,2,3,3,3-hexafluoropropyl)-1,4-dioxane |
|---|---|
| PubChem CID | 13271507 |
| Molecular Formula | C7H8F6O2 |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-(1,1,2,3,3,3-hexafluoropropyl)-1,4-dioxane |
| SMILES | FC(C(F)(F)F)C(F)(F)C1COCCO1 |
| InChI | InChI=1S/C7H8F6O2/c8-5(7(11,12)13)6(9,10)4-3-14-1-2-15-4/h4-5H,1-3H2 |
| InChIKey | NNTBXTUVWBLBKN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |