C7H10F6O — CID 13271509
4-ethoxy-1,1,1,2,3,3-hexafluoropentane (PubChem CID 13271509) has the molecular formula C7H10F6O and a molecular weight of 224.14 g/mol. Its IUPAC name is 4-ethoxy-1,1,1,2,3,3-hexafluoropentane.
| Compound Name | 4-ethoxy-1,1,1,2,3,3-hexafluoropentane |
|---|---|
| PubChem CID | 13271509 |
| Molecular Formula | C7H10F6O |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-ethoxy-1,1,1,2,3,3-hexafluoropentane |
| SMILES | CCOC(C)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6O/c1-3-14-4(2)6(9,10)5(8)7(11,12)13/h4-5H,3H2,1-2H3 |
| InChIKey | YSJPWKICFXZRAH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |