C10F22O — CID 13271512
1,1,1,2,2,3,3,4,5,5,5-undecafluoro-4-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yloxy)pentane (PubChem CID 13271512) has the molecular formula C10F22O and a molecular weight of 554.06 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,5,5,5-undecafluoro-4-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yloxy)pentane.
| Compound Name | 1,1,1,2,2,3,3,4,5,5,5-undecafluoro-4-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yloxy)pentane |
|---|---|
| PubChem CID | 13271512 |
| Molecular Formula | C10F22O |
| Molecular Weight | 554.06 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | 1,1,1,2,2,3,3,4,5,5,5-undecafluoro-4-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yloxy)pentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(OC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10F22O/c11-1(12,3(15,16)7(21,22)23)5(19,9(27,28)29)33-6(20,10(30,31)32)2(13,14)4(17,18)8(24,25)26 |
| InChIKey | TWKUPTMUBKZFFA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.06 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|