About N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine
N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine (PubChem CID 13271938) has the molecular formula C18H15N5
and a molecular weight of 301.35 g/mol. Its IUPAC name is N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine.
Molecular Properties
| Compound Name | N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine |
| PubChem CID | 13271938 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine |
| SMILES | CN(c1ccccc1)c1cnc2c(cnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C18H15N5/c1-22(14-8-4-2-5-9-14)17-13-19-18-16(21-17)12-20-23(18)15-10-6-3-7-11-15/h2-13H,1H3 |
| InChIKey | AWEYLOHYJGTCAK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine?
The IUPAC name of N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine (CID 13271938) is N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine.
What is the SMILES notation for N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine?
The canonical SMILES for N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine is CN(c1ccccc1)c1cnc2c(cnn2-c2ccccc2)n1.
What is the InChIKey of N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine?
The InChIKey is AWEYLOHYJGTCAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5/c1-22(14-8-4-2-5-9-14)17-13-19-18-16(21-17)12-20-23(18)15-10-6-3-7-11-15/h2-13H,1H3.
What are the key properties of N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine?
N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine has a molecular weight of 301.35 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N,1-diphenylpyrazolo[3,4-b]pyrazin-5-amine is sourced from PubChem (CID 13271938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).