C14H19F4O3PS2 — CID 13272081
1-[ethoxy(propylsulfanyl)phosphoryl]oxy-4-(2,2,3,3-tetrafluoropropylsulfanyl)benzene (PubChem CID 13272081) has the molecular formula C14H19F4O3PS2 and a molecular weight of 406.40 g/mol. Its IUPAC name is 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-4-(2,2,3,3-tetrafluoropropylsulfanyl)benzene.
| Compound Name | 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-4-(2,2,3,3-tetrafluoropropylsulfanyl)benzene |
|---|---|
| PubChem CID | 13272081 |
| Molecular Formula | C14H19F4O3PS2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-4-(2,2,3,3-tetrafluoropropylsulfanyl)benzene |
| SMILES | CCCSP(=O)(OCC)Oc1ccc(SCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C14H19F4O3PS2/c1-3-9-24-22(19,20-4-2)21-11-5-7-12(8-6-11)23-10-14(17,18)13(15)16/h5-8,13H,3-4,9-10H2,1-2H3 |
| InChIKey | SIVHHTALLMSPPS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|