C26H35ClN2O4 — CID 132723651
2-[4-(4-chlorophenoxy)butanoyl-[(3-methoxyphenyl)methyl]amino]-N-(2-methylpropyl)butanamide (PubChem CID 132723651) has the molecular formula C26H35ClN2O4 and a molecular weight of 475.03 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)butanoyl-[(3-methoxyphenyl)methyl]amino]-N-(2-methylpropyl)butanamide.
| Compound Name | 2-[4-(4-chlorophenoxy)butanoyl-[(3-methoxyphenyl)methyl]amino]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 132723651 |
| Molecular Formula | C26H35ClN2O4 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)butanoyl-[(3-methoxyphenyl)methyl]amino]-N-(2-methylpropyl)butanamide |
| SMILES | CCC(C(=O)NCC(C)C)N(Cc1cccc(OC)c1)C(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H35ClN2O4/c1-5-24(26(31)28-17-19(2)3)29(18-20-8-6-9-23(16-20)32-4)25(30)10-7-15-33-22-13-11-21(27)12-14-22/h6,8-9,11-14,16,19,24H,5,7,10,15,17-18H2,1-4H3,(H,28,31) |
| InChIKey | LEKPADHBQOKVBH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|