C25H32Cl2N2O3 — CID 132724844
N-butyl-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-[(4-chlorophenyl)methyl]amino]butanamide (PubChem CID 132724844) has the molecular formula C25H32Cl2N2O3 and a molecular weight of 479.45 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-[(4-chlorophenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-[(4-chlorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132724844 |
| Molecular Formula | C25H32Cl2N2O3 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-butyl-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-[(4-chlorophenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1)C(=O)COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C25H32Cl2N2O3/c1-5-7-12-28-25(31)22(6-2)29(15-19-8-10-20(26)11-9-19)23(30)16-32-21-13-17(3)24(27)18(4)14-21/h8-11,13-14,22H,5-7,12,15-16H2,1-4H3,(H,28,31) |
| InChIKey | KFJLCPCEYBWEJB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|