C23H29Cl2N3O4S — CID 132729354
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-methylsulfonylanilino)acetyl]amino]propanamide (PubChem CID 132729354) has the molecular formula C23H29Cl2N3O4S and a molecular weight of 514.48 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-methylsulfonylanilino)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-methylsulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132729354 |
| Molecular Formula | C23H29Cl2N3O4S |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(N-methylsulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H29Cl2N3O4S/c1-4-5-13-26-23(30)17(2)27(15-18-11-12-20(24)21(25)14-18)22(29)16-28(33(3,31)32)19-9-7-6-8-10-19/h6-12,14,17H,4-5,13,15-16H2,1-3H3,(H,26,30) |
| InChIKey | GWIWHAOIMXSFOW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|