C26H36FN3O5S — CID 132731404
N-butyl-2-[[2-(4-ethoxy-N-methylsulfonylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide (PubChem CID 132731404) has the molecular formula C26H36FN3O5S and a molecular weight of 521.66 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-ethoxy-N-methylsulfonylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(4-ethoxy-N-methylsulfonylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132731404 |
| Molecular Formula | C26H36FN3O5S |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N-butyl-2-[[2-(4-ethoxy-N-methylsulfonylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(F)cc1)C(=O)CN(c1ccc(OCC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H36FN3O5S/c1-5-8-17-28-26(32)24(6-2)29(18-20-9-11-21(27)12-10-20)25(31)19-30(36(4,33)34)22-13-15-23(16-14-22)35-7-3/h9-16,24H,5-8,17-19H2,1-4H3,(H,28,32) |
| InChIKey | VIGMDZURSMBQRF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|