C29H43N3O4S — CID 132733528
N-butyl-2-[4-(4-ethyl-N-methylsulfonylanilino)butanoyl-(2-phenylethyl)amino]butanamide (PubChem CID 132733528) has the molecular formula C29H43N3O4S and a molecular weight of 529.75 g/mol. Its IUPAC name is N-butyl-2-[4-(4-ethyl-N-methylsulfonylanilino)butanoyl-(2-phenylethyl)amino]butanamide.
| Compound Name | N-butyl-2-[4-(4-ethyl-N-methylsulfonylanilino)butanoyl-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132733528 |
| Molecular Formula | C29H43N3O4S |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | N-butyl-2-[4-(4-ethyl-N-methylsulfonylanilino)butanoyl-(2-phenylethyl)amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(CCc1ccccc1)C(=O)CCCN(c1ccc(CC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C29H43N3O4S/c1-5-8-21-30-29(34)27(7-3)31(23-20-25-13-10-9-11-14-25)28(33)15-12-22-32(37(4,35)36)26-18-16-24(6-2)17-19-26/h9-11,13-14,16-19,27H,5-8,12,15,20-23H2,1-4H3,(H,30,34) |
| InChIKey | UQNRXERXCUYWIF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|