About 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one
6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one (PubChem CID 1327337) has the molecular formula C19H14BrNO3
and a molecular weight of 384.23 g/mol. Its IUPAC name is 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one.
Molecular Properties
| Compound Name | 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one |
| PubChem CID | 1327337 |
| Molecular Formula | C19H14BrNO3 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one |
| SMILES | O=C(c1cc2cc(Br)ccc2oc1=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H14BrNO3/c20-14-7-8-17-13(10-14)11-15(19(23)24-17)18(22)21-9-3-5-12-4-1-2-6-16(12)21/h1-2,4,6-8,10-11H,3,5,9H2 |
| InChIKey | HYWRNTDNLKOPPY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one?
The IUPAC name of 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one (CID 1327337) is 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one.
What is the SMILES notation for 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one?
The canonical SMILES for 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one is O=C(c1cc2cc(Br)ccc2oc1=O)N1CCCc2ccccc21.
What is the InChIKey of 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one?
The InChIKey is HYWRNTDNLKOPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14BrNO3/c20-14-7-8-17-13(10-14)11-15(19(23)24-17)18(22)21-9-3-5-12-4-1-2-6-16(12)21/h1-2,4,6-8,10-11H,3,5,9H2.
What are the key properties of 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one?
6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one has a molecular weight of 384.23 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(3,4-dihydro-2H-quinoline-1-carbonyl)chromen-2-one is sourced from PubChem (CID 1327337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).