C26H36ClN3O5S — CID 132735680
N-butyl-2-[[2-(5-chloro-2-methoxy-N-methylsulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]butanamide (PubChem CID 132735680) has the molecular formula C26H36ClN3O5S and a molecular weight of 538.11 g/mol. Its IUPAC name is N-butyl-2-[[2-(5-chloro-2-methoxy-N-methylsulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(5-chloro-2-methoxy-N-methylsulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132735680 |
| Molecular Formula | C26H36ClN3O5S |
| Molecular Weight | 538.11 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | N-butyl-2-[[2-(5-chloro-2-methoxy-N-methylsulfonylanilino)acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(C)cc1)C(=O)CN(c1cc(Cl)ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C26H36ClN3O5S/c1-6-8-15-28-26(32)22(7-2)29(17-20-11-9-19(3)10-12-20)25(31)18-30(36(5,33)34)23-16-21(27)13-14-24(23)35-4/h9-14,16,22H,6-8,15,17-18H2,1-5H3,(H,28,32) |
| InChIKey | MZYLKWHGMXHSFA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.11 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|