About trimethyl(tetradec-13-en-1,7-diynyl)silane
trimethyl(tetradec-13-en-1,7-diynyl)silane (PubChem CID 13273617) has the molecular formula C17H28Si
and a molecular weight of 260.50 g/mol. Its IUPAC name is trimethyl(tetradec-13-en-1,7-diynyl)silane.
Molecular Properties
| Compound Name | trimethyl(tetradec-13-en-1,7-diynyl)silane |
| PubChem CID | 13273617 |
| Molecular Formula | C17H28Si |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | trimethyl(tetradec-13-en-1,7-diynyl)silane |
| SMILES | C=CCCCCC#CCCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C17H28Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2,3)4/h5H,1,6-9,12-15H2,2-4H3 |
| InChIKey | GAOYGDNCZGTWKJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(tetradec-13-en-1,7-diynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(tetradec-13-en-1,7-diynyl)silane?
The IUPAC name of trimethyl(tetradec-13-en-1,7-diynyl)silane (CID 13273617) is trimethyl(tetradec-13-en-1,7-diynyl)silane.
What is the SMILES notation for trimethyl(tetradec-13-en-1,7-diynyl)silane?
The canonical SMILES for trimethyl(tetradec-13-en-1,7-diynyl)silane is C=CCCCCC#CCCCCC#C[Si](C)(C)C.
What is the InChIKey of trimethyl(tetradec-13-en-1,7-diynyl)silane?
The InChIKey is GAOYGDNCZGTWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2,3)4/h5H,1,6-9,12-15H2,2-4H3.
What are the key properties of trimethyl(tetradec-13-en-1,7-diynyl)silane?
trimethyl(tetradec-13-en-1,7-diynyl)silane has a molecular weight of 260.50 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(tetradec-13-en-1,7-diynyl)silane is sourced from PubChem (CID 13273617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).